C23H24N2O4 — CID 17410688
2-[4-[(E)-3-(4-cyanophenyl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N,N-dimethylpropanamide (PubChem CID 17410688) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[4-[(E)-3-(4-cyanophenyl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N,N-dimethylpropanamide.
| Compound Name | 2-[4-[(E)-3-(4-cyanophenyl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 17410688 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-[4-[(E)-3-(4-cyanophenyl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N,N-dimethylpropanamide |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccc(C#N)cc2)ccc1OC(C)C(=O)N(C)C |
| InChI | InChI=1S/C23H24N2O4/c1-5-28-22-14-17(9-13-21(22)29-16(2)23(27)25(3)4)8-12-20(26)19-10-6-18(15-24)7-11-19/h6-14,16H,5H2,1-4H3/b12-8+ |
| InChIKey | ZDZXNCMOXSCRAK-XYOKQWHBSA-N |
| XLogP | 3.71 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|