C20H19NO3 — CID 6215119
4-[(E)-3-(4-methoxy-3-propoxyphenyl)prop-2-enoyl]benzonitrile (PubChem CID 6215119) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[(E)-3-(4-methoxy-3-propoxyphenyl)prop-2-enoyl]benzonitrile.
| Compound Name | 4-[(E)-3-(4-methoxy-3-propoxyphenyl)prop-2-enoyl]benzonitrile |
|---|---|
| PubChem CID | 6215119 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-[(E)-3-(4-methoxy-3-propoxyphenyl)prop-2-enoyl]benzonitrile |
| SMILES | CCCOc1cc(/C=C/C(=O)c2ccc(C#N)cc2)ccc1OC |
| InChI | InChI=1S/C20H19NO3/c1-3-12-24-20-13-15(7-11-19(20)23-2)6-10-18(22)17-8-4-16(14-21)5-9-17/h4-11,13H,3,12H2,1-2H3/b10-6+ |
| InChIKey | MKENUFOPNFLUGH-UXBLZVDNSA-N |
| XLogP | 4.25 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|