C23H27NO4 — CID 9448352
(2S)-2-[2-ethoxy-4-[(E)-3-(2-methylphenyl)-3-oxoprop-1-enyl]phenoxy]-N,N-dimethylpropanamide (PubChem CID 9448352) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (2S)-2-[2-ethoxy-4-[(E)-3-(2-methylphenyl)-3-oxoprop-1-enyl]phenoxy]-N,N-dimethylpropanamide.
| Compound Name | (2S)-2-[2-ethoxy-4-[(E)-3-(2-methylphenyl)-3-oxoprop-1-enyl]phenoxy]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 9448352 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (2S)-2-[2-ethoxy-4-[(E)-3-(2-methylphenyl)-3-oxoprop-1-enyl]phenoxy]-N,N-dimethylpropanamide |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccccc2C)ccc1O[C@@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C23H27NO4/c1-6-27-22-15-18(11-13-20(25)19-10-8-7-9-16(19)2)12-14-21(22)28-17(3)23(26)24(4)5/h7-15,17H,6H2,1-5H3/b13-11+/t17-/m0/s1 |
| InChIKey | BOFCUELNVNUMQG-HVJHFUJKSA-N |
| XLogP | 4.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|