C24H29NO3 — CID 18178668
(E)-1-(4-aminophenyl)-3-[2,4-di(propan-2-yloxy)-5-prop-2-enylphenyl]prop-2-en-1-one (PubChem CID 18178668) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is (E)-1-(4-aminophenyl)-3-[2,4-di(propan-2-yloxy)-5-prop-2-enylphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-aminophenyl)-3-[2,4-di(propan-2-yloxy)-5-prop-2-enylphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 18178668 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (E)-1-(4-aminophenyl)-3-[2,4-di(propan-2-yloxy)-5-prop-2-enylphenyl]prop-2-en-1-one |
| SMILES | C=CCc1cc(/C=C/C(=O)c2ccc(N)cc2)c(OC(C)C)cc1OC(C)C |
| InChI | InChI=1S/C24H29NO3/c1-6-7-19-14-20(10-13-22(26)18-8-11-21(25)12-9-18)24(28-17(4)5)15-23(19)27-16(2)3/h6,8-17H,1,7,25H2,2-5H3/b13-10+ |
| InChIKey | QMUXPAGRESQRQR-JLHYYAGUSA-N |
| XLogP | 5.47 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|