C22H22O4 — CID 18178142
(E)-3-[4-hydroxy-2-methoxy-3,5-bis(prop-2-enyl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 18178142) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is (E)-3-[4-hydroxy-2-methoxy-3,5-bis(prop-2-enyl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-hydroxy-2-methoxy-3,5-bis(prop-2-enyl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18178142 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (E)-3-[4-hydroxy-2-methoxy-3,5-bis(prop-2-enyl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | C=CCc1cc(/C=C/C(=O)c2ccc(O)cc2)c(OC)c(CC=C)c1O |
| InChI | InChI=1S/C22H22O4/c1-4-6-16-14-17(22(26-3)19(7-5-2)21(16)25)10-13-20(24)15-8-11-18(23)12-9-15/h4-5,8-14,23,25H,1-2,6-7H2,3H3/b13-10+ |
| InChIKey | SHOYJNJLLJHALN-JLHYYAGUSA-N |
| XLogP | 4.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|