C17H14Cl2O4 — CID 137379036
3-(3,4-dichloro-2,5-dimethoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 137379036) has the molecular formula C17H14Cl2O4 and a molecular weight of 353.20 g/mol. Its IUPAC name is 3-(3,4-dichloro-2,5-dimethoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(3,4-dichloro-2,5-dimethoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 137379036 |
| Molecular Formula | C17H14Cl2O4 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 3-(3,4-dichloro-2,5-dimethoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc(O)cc2)c(OC)c(Cl)c1Cl |
| InChI | InChI=1S/C17H14Cl2O4/c1-22-14-9-11(17(23-2)16(19)15(14)18)5-8-13(21)10-3-6-12(20)7-4-10/h3-9,20H,1-2H3 |
| InChIKey | SBRYUOIVGUEAKU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|