C18H18O4 — CID 67777793
(E)-3-(3,5-dimethoxy-2-methylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 67777793) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxy-2-methylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethoxy-2-methylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67777793 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (E)-3-(3,5-dimethoxy-2-methylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(O)cc2)c(C)c(OC)c1 |
| InChI | InChI=1S/C18H18O4/c1-12-14(10-16(21-2)11-18(12)22-3)6-9-17(20)13-4-7-15(19)8-5-13/h4-11,19H,1-3H3/b9-6+ |
| InChIKey | CCIXBABDNXPKNQ-RMKNXTFCSA-N |
| XLogP | 3.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|