C27H36O4 — CID 54426492
3-[2-tert-butyl-3,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 54426492) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is 3-[2-tert-butyl-3,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[2-tert-butyl-3,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54426492 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 3-[2-tert-butyl-3,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | CC(C)(C)Oc1cc(C=CC(=O)c2ccc(O)cc2)c(C(C)(C)C)c(OC(C)(C)C)c1 |
| InChI | InChI=1S/C27H36O4/c1-25(2,3)24-19(12-15-22(29)18-10-13-20(28)14-11-18)16-21(30-26(4,5)6)17-23(24)31-27(7,8)9/h10-17,28H,1-9H3 |
| InChIKey | WELRDSNAEUQZEG-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|