C26H34O4 — CID 67778896
(E)-3-[3,5-bis[(2-methylpropan-2-yl)oxy]-4-propylphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 67778896) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (E)-3-[3,5-bis[(2-methylpropan-2-yl)oxy]-4-propylphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3,5-bis[(2-methylpropan-2-yl)oxy]-4-propylphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67778896 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (E)-3-[3,5-bis[(2-methylpropan-2-yl)oxy]-4-propylphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | CCCc1c(OC(C)(C)C)cc(/C=C/C(=O)c2ccc(O)cc2)cc1OC(C)(C)C |
| InChI | InChI=1S/C26H34O4/c1-8-9-21-23(29-25(2,3)4)16-18(17-24(21)30-26(5,6)7)10-15-22(28)19-11-13-20(27)14-12-19/h10-17,27H,8-9H2,1-7H3/b15-10+ |
| InChIKey | QDERXCVELTYZIZ-XNTDXEJSSA-N |
| XLogP | 6.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|