C24H30O4 — CID 54522447
1-(4-hydroxyphenyl)-3-[5-methyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one (PubChem CID 54522447) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-[5-methyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one.
| Compound Name | 1-(4-hydroxyphenyl)-3-[5-methyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 54522447 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-[5-methyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one |
| SMILES | Cc1cc(C=CC(=O)c2ccc(O)cc2)c(OC(C)(C)C)cc1OC(C)(C)C |
| InChI | InChI=1S/C24H30O4/c1-16-14-18(10-13-20(26)17-8-11-19(25)12-9-17)22(28-24(5,6)7)15-21(16)27-23(2,3)4/h8-15,25H,1-7H3 |
| InChIKey | YQTUOUVBFKMXGY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|