C19H19ClO5 — CID 134884858
(E)-3-(4-chloro-2,3-dimethoxyphenyl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 134884858) has the molecular formula C19H19ClO5 and a molecular weight of 362.81 g/mol. Its IUPAC name is (E)-3-(4-chloro-2,3-dimethoxyphenyl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-chloro-2,3-dimethoxyphenyl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 134884858 |
| Molecular Formula | C19H19ClO5 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (E)-3-(4-chloro-2,3-dimethoxyphenyl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(Cl)c(OC)c2OC)cc1OC |
| InChI | InChI=1S/C19H19ClO5/c1-22-16-10-7-13(11-17(16)23-2)15(21)9-6-12-5-8-14(20)19(25-4)18(12)24-3/h5-11H,1-4H3/b9-6+ |
| InChIKey | GECNFXFNISLYQF-RMKNXTFCSA-N |
| XLogP | 4.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|