C18H17ClO5 — CID 7947778
(E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 7947778) has the molecular formula C18H17ClO5 and a molecular weight of 348.78 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7947778 |
| Molecular Formula | C18H17ClO5 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cc(Cl)c(O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C18H17ClO5/c1-22-15-7-5-12(10-16(15)23-2)14(20)6-4-11-8-13(19)18(21)17(9-11)24-3/h4-10,21H,1-3H3/b6-4+ |
| InChIKey | NHGXSQWCNNSKFW-GQCTYLIASA-N |
| XLogP | 3.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|