C23H26O6 — CID 18178834
(E)-3-[2-methoxy-4-(methoxymethoxy)-5-prop-2-enylphenyl]-1-[4-(methoxymethoxy)phenyl]prop-2-en-1-one (PubChem CID 18178834) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is (E)-3-[2-methoxy-4-(methoxymethoxy)-5-prop-2-enylphenyl]-1-[4-(methoxymethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[2-methoxy-4-(methoxymethoxy)-5-prop-2-enylphenyl]-1-[4-(methoxymethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 18178834 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (E)-3-[2-methoxy-4-(methoxymethoxy)-5-prop-2-enylphenyl]-1-[4-(methoxymethoxy)phenyl]prop-2-en-1-one |
| SMILES | C=CCc1cc(/C=C/C(=O)c2ccc(OCOC)cc2)c(OC)cc1OCOC |
| InChI | InChI=1S/C23H26O6/c1-5-6-18-13-19(22(27-4)14-23(18)29-16-26-3)9-12-21(24)17-7-10-20(11-8-17)28-15-25-2/h5,7-14H,1,6,15-16H2,2-4H3/b12-9+ |
| InChIKey | ZVXQFOQYALBSIR-FMIVXFBMSA-N |
| XLogP | 4.29 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|