C28H34O6 — CID 18178766
[4-[(E)-3-(2,4-diethoxy-5-prop-2-enylphenyl)prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 18178766) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is [4-[(E)-3-(2,4-diethoxy-5-prop-2-enylphenyl)prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[(E)-3-(2,4-diethoxy-5-prop-2-enylphenyl)prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 18178766 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [4-[(E)-3-(2,4-diethoxy-5-prop-2-enylphenyl)prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | C=CCc1cc(/C=C/C(=O)c2ccc(OCOC(=O)C(C)(C)C)cc2)c(OCC)cc1OCC |
| InChI | InChI=1S/C28H34O6/c1-7-10-21-17-22(26(32-9-3)18-25(21)31-8-2)13-16-24(29)20-11-14-23(15-12-20)33-19-34-27(30)28(4,5)6/h7,11-18H,1,8-10,19H2,2-6H3/b16-13+ |
| InChIKey | FTLPSHUJLGUHNL-DTQAZKPQSA-N |
| XLogP | 6.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|