C28H36O6 — CID 54111163
[4-[3-(5-methyl-2,4-dipropoxyphenyl)prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 54111163) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is [4-[3-(5-methyl-2,4-dipropoxyphenyl)prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[3-(5-methyl-2,4-dipropoxyphenyl)prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54111163 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [4-[3-(5-methyl-2,4-dipropoxyphenyl)prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CCCOc1cc(OCCC)c(C=CC(=O)c2ccc(OCOC(=O)C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C28H36O6/c1-7-15-31-25-18-26(32-16-8-2)22(17-20(25)3)11-14-24(29)21-9-12-23(13-10-21)33-19-34-27(30)28(4,5)6/h9-14,17-18H,7-8,15-16,19H2,1-6H3 |
| InChIKey | NHENDYJTZYGILS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|