C35H48O8 — CID 18179084
[4-[(E)-3-[4-(2,2-dimethylpropanoyloxymethoxy)-5-(2-methylbutan-2-yl)-2-propoxyphenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 18179084) has the molecular formula C35H48O8 and a molecular weight of 596.76 g/mol. Its IUPAC name is [4-[(E)-3-[4-(2,2-dimethylpropanoyloxymethoxy)-5-(2-methylbutan-2-yl)-2-propoxyphenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[(E)-3-[4-(2,2-dimethylpropanoyloxymethoxy)-5-(2-methylbutan-2-yl)-2-propoxyphenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 18179084 |
| Molecular Formula | C35H48O8 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | [4-[(E)-3-[4-(2,2-dimethylpropanoyloxymethoxy)-5-(2-methylbutan-2-yl)-2-propoxyphenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CCCOc1cc(OCOC(=O)C(C)(C)C)c(C(C)(C)CC)cc1/C=C/C(=O)c1ccc(OCOC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H48O8/c1-11-19-39-29-21-30(41-23-43-32(38)34(6,7)8)27(35(9,10)12-2)20-25(29)15-18-28(36)24-13-16-26(17-14-24)40-22-42-31(37)33(3,4)5/h13-18,20-21H,11-12,19,22-23H2,1-10H3/b18-15+ |
| InChIKey | PITKAKWAYXDTCZ-OBGWFSINSA-N |
| XLogP | 7.91 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|