C29H39NO3 — CID 18179154
(E)-3-[2,4-dibutoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-[4-(methylamino)phenyl]prop-2-en-1-one (PubChem CID 18179154) has the molecular formula C29H39NO3 and a molecular weight of 449.64 g/mol. Its IUPAC name is (E)-3-[2,4-dibutoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-[4-(methylamino)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[2,4-dibutoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-[4-(methylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 18179154 |
| Molecular Formula | C29H39NO3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | (E)-3-[2,4-dibutoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-[4-(methylamino)phenyl]prop-2-en-1-one |
| SMILES | C=CC(C)(C)c1cc(/C=C/C(=O)c2ccc(NC)cc2)c(OCCCC)cc1OCCCC |
| InChI | InChI=1S/C29H39NO3/c1-7-10-18-32-27-21-28(33-19-11-8-2)25(29(4,5)9-3)20-23(27)14-17-26(31)22-12-15-24(30-6)16-13-22/h9,12-17,20-21,30H,3,7-8,10-11,18-19H2,1-2,4-6H3/b17-14+ |
| InChIKey | PHKIWQINJUTQFL-SAPNQHFASA-N |
| XLogP | 7.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|