C38H54O8 — CID 57107724
[4-[3-[2-(2,2-dimethylpropanoyloxymethoxy)-6-methoxy-3,5-bis(2-methylbutan-2-yl)phenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 57107724) has the molecular formula C38H54O8 and a molecular weight of 638.84 g/mol. Its IUPAC name is [4-[3-[2-(2,2-dimethylpropanoyloxymethoxy)-6-methoxy-3,5-bis(2-methylbutan-2-yl)phenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[3-[2-(2,2-dimethylpropanoyloxymethoxy)-6-methoxy-3,5-bis(2-methylbutan-2-yl)phenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57107724 |
| Molecular Formula | C38H54O8 |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | [4-[3-[2-(2,2-dimethylpropanoyloxymethoxy)-6-methoxy-3,5-bis(2-methylbutan-2-yl)phenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CCC(C)(C)c1cc(C(C)(C)CC)c(OCOC(=O)C(C)(C)C)c(C=CC(=O)c2ccc(OCOC(=O)C(C)(C)C)cc2)c1OC |
| InChI | InChI=1S/C38H54O8/c1-14-37(9,10)28-22-29(38(11,12)15-2)32(44-24-46-34(41)36(6,7)8)27(31(28)42-13)20-21-30(39)25-16-18-26(19-17-25)43-23-45-33(40)35(3,4)5/h16-22H,14-15,23-24H2,1-13H3 |
| InChIKey | KFQMIIYINTZSOA-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|