C36H46O8 — CID 18178843
[4-[(E)-3-[3,5-bis[(E)-but-2-enyl]-2-(2,2-dimethylpropanoyloxymethoxy)-6-methoxyphenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 18178843) has the molecular formula C36H46O8 and a molecular weight of 606.76 g/mol. Its IUPAC name is [4-[(E)-3-[3,5-bis[(E)-but-2-enyl]-2-(2,2-dimethylpropanoyloxymethoxy)-6-methoxyphenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[(E)-3-[3,5-bis[(E)-but-2-enyl]-2-(2,2-dimethylpropanoyloxymethoxy)-6-methoxyphenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 18178843 |
| Molecular Formula | C36H46O8 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | [4-[(E)-3-[3,5-bis[(E)-but-2-enyl]-2-(2,2-dimethylpropanoyloxymethoxy)-6-methoxyphenyl]prop-2-enoyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | C/C=C/Cc1cc(C/C=C/C)c(OCOC(=O)C(C)(C)C)c(/C=C/C(=O)c2ccc(OCOC(=O)C(C)(C)C)cc2)c1OC |
| InChI | InChI=1S/C36H46O8/c1-10-12-14-26-22-27(15-13-11-2)32(42-24-44-34(39)36(6,7)8)29(31(26)40-9)20-21-30(37)25-16-18-28(19-17-25)41-23-43-33(38)35(3,4)5/h10-13,16-22H,14-15,23-24H2,1-9H3/b12-10+,13-11+,21-20+ |
| InChIKey | XOKKZHOGSYMPFC-YJFDWDTFSA-N |
| XLogP | 7.68 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|