C24H30O4 — CID 54070551
3-(2,6-dipropoxy-3-propylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 54070551) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3-(2,6-dipropoxy-3-propylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(2,6-dipropoxy-3-propylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54070551 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 3-(2,6-dipropoxy-3-propylphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(CCC)c(OCCC)c1C=CC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H30O4/c1-4-7-19-10-15-23(27-16-5-2)21(24(19)28-17-6-3)13-14-22(26)18-8-11-20(25)12-9-18/h8-15,25H,4-7,16-17H2,1-3H3 |
| InChIKey | MGCXQSWUSIMTLL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|