About 3-propoxy-4-propylphenol
3-propoxy-4-propylphenol (PubChem CID 22123839) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-propoxy-4-propylphenol.
Molecular Properties
| Compound Name | 3-propoxy-4-propylphenol |
| PubChem CID | 22123839 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-propoxy-4-propylphenol |
| SMILES | CCCOc1cc(O)ccc1CCC |
| InChI | InChI=1S/C12H18O2/c1-3-5-10-6-7-11(13)9-12(10)14-8-4-2/h6-7,9,13H,3-5,8H2,1-2H3 |
| InChIKey | FEIMQOWGOVLLCM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propoxy-4-propylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxy-4-propylphenol?
The IUPAC name of 3-propoxy-4-propylphenol (CID 22123839) is 3-propoxy-4-propylphenol.
What is the SMILES notation for 3-propoxy-4-propylphenol?
The canonical SMILES for 3-propoxy-4-propylphenol is CCCOc1cc(O)ccc1CCC.
What is the InChIKey of 3-propoxy-4-propylphenol?
The InChIKey is FEIMQOWGOVLLCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-3-5-10-6-7-11(13)9-12(10)14-8-4-2/h6-7,9,13H,3-5,8H2,1-2H3.
What are the key properties of 3-propoxy-4-propylphenol?
3-propoxy-4-propylphenol has a molecular weight of 194.27 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxy-4-propylphenol is sourced from PubChem (CID 22123839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).