About 3-butoxy-4-fluorophenol
3-butoxy-4-fluorophenol (PubChem CID 174949463) has the molecular formula C10H13FO2
and a molecular weight of 184.21 g/mol. Its IUPAC name is 3-butoxy-4-fluorophenol.
Molecular Properties
| Compound Name | 3-butoxy-4-fluorophenol |
| PubChem CID | 174949463 |
| Molecular Formula | C10H13FO2 |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 3-butoxy-4-fluorophenol |
| SMILES | CCCCOc1cc(O)ccc1F |
| InChI | InChI=1S/C10H13FO2/c1-2-3-6-13-10-7-8(12)4-5-9(10)11/h4-5,7,12H,2-3,6H2,1H3 |
| InChIKey | JJJDZXHEIAUIIN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-4-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-4-fluorophenol?
The IUPAC name of 3-butoxy-4-fluorophenol (CID 174949463) is 3-butoxy-4-fluorophenol.
What is the SMILES notation for 3-butoxy-4-fluorophenol?
The canonical SMILES for 3-butoxy-4-fluorophenol is CCCCOc1cc(O)ccc1F.
What is the InChIKey of 3-butoxy-4-fluorophenol?
The InChIKey is JJJDZXHEIAUIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO2/c1-2-3-6-13-10-7-8(12)4-5-9(10)11/h4-5,7,12H,2-3,6H2,1H3.
What are the key properties of 3-butoxy-4-fluorophenol?
3-butoxy-4-fluorophenol has a molecular weight of 184.21 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-4-fluorophenol is sourced from PubChem (CID 174949463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).