About 3-butoxy-4-methylphenol
3-butoxy-4-methylphenol (PubChem CID 54016675) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-butoxy-4-methylphenol.
Molecular Properties
| Compound Name | 3-butoxy-4-methylphenol |
| PubChem CID | 54016675 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 3-butoxy-4-methylphenol |
| SMILES | CCCCOc1cc(O)ccc1C |
| InChI | InChI=1S/C11H16O2/c1-3-4-7-13-11-8-10(12)6-5-9(11)2/h5-6,8,12H,3-4,7H2,1-2H3 |
| InChIKey | KWCIVCUHYKCRNJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-4-methylphenol?
The IUPAC name of 3-butoxy-4-methylphenol (CID 54016675) is 3-butoxy-4-methylphenol.
What is the SMILES notation for 3-butoxy-4-methylphenol?
The canonical SMILES for 3-butoxy-4-methylphenol is CCCCOc1cc(O)ccc1C.
What is the InChIKey of 3-butoxy-4-methylphenol?
The InChIKey is KWCIVCUHYKCRNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-3-4-7-13-11-8-10(12)6-5-9(11)2/h5-6,8,12H,3-4,7H2,1-2H3.
What are the key properties of 3-butoxy-4-methylphenol?
3-butoxy-4-methylphenol has a molecular weight of 180.25 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-4-methylphenol is sourced from PubChem (CID 54016675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).