C26H33NO4 — CID 18178113
4-[(E)-3-(3-tert-butyl-2,6-diethoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzamide (PubChem CID 18178113) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 4-[(E)-3-(3-tert-butyl-2,6-diethoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(E)-3-(3-tert-butyl-2,6-diethoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 18178113 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 4-[(E)-3-(3-tert-butyl-2,6-diethoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzamide |
| SMILES | CCOc1ccc(C(C)(C)C)c(OCC)c1/C=C/C(=O)c1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C26H33NO4/c1-8-30-23-17-15-21(26(3,4)5)24(31-9-2)20(23)14-16-22(28)18-10-12-19(13-11-18)25(29)27(6)7/h10-17H,8-9H2,1-7H3/b16-14+ |
| InChIKey | QEYNMDDRHPYKDK-JQIJEIRASA-N |
| XLogP | 5.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|