C24H29NO4 — CID 18178089
4-[(E)-3-[2,6-di(propan-2-yloxy)phenyl]prop-2-enoyl]-N,N-dimethylbenzamide (PubChem CID 18178089) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 4-[(E)-3-[2,6-di(propan-2-yloxy)phenyl]prop-2-enoyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(E)-3-[2,6-di(propan-2-yloxy)phenyl]prop-2-enoyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 18178089 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-[(E)-3-[2,6-di(propan-2-yloxy)phenyl]prop-2-enoyl]-N,N-dimethylbenzamide |
| SMILES | CC(C)Oc1cccc(OC(C)C)c1/C=C/C(=O)c1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-16(2)28-22-8-7-9-23(29-17(3)4)20(22)14-15-21(26)18-10-12-19(13-11-18)24(27)25(5)6/h7-17H,1-6H3/b15-14+ |
| InChIKey | DTGMHKWXEUJXIX-CCEZHUSRSA-N |
| XLogP | 4.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|