C26H30N2O5 — CID 70015525
2-[2-[4-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]phenyl]ethylidene]-N,N,N',N'-tetramethylpropanediamide (PubChem CID 70015525) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-[2-[4-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]phenyl]ethylidene]-N,N,N',N'-tetramethylpropanediamide.
| Compound Name | 2-[2-[4-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]phenyl]ethylidene]-N,N,N',N'-tetramethylpropanediamide |
|---|---|
| PubChem CID | 70015525 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2-[2-[4-[(E)-3-(2,6-dimethoxyphenyl)prop-2-enoyl]phenyl]ethylidene]-N,N,N',N'-tetramethylpropanediamide |
| SMILES | COc1cccc(OC)c1/C=C/C(=O)c1ccc(CC=C(C(=O)N(C)C)C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C26H30N2O5/c1-27(2)25(30)21(26(31)28(3)4)15-12-18-10-13-19(14-11-18)22(29)17-16-20-23(32-5)8-7-9-24(20)33-6/h7-11,13-17H,12H2,1-6H3/b17-16+ |
| InChIKey | QQEYBAMSUNOQCM-WUKNDPDISA-N |
| XLogP | 3.25 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|