C21H24O5 — CID 24828195
(E)-1-(2,6-diethoxyphenyl)-3-(2,6-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 24828195) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (E)-1-(2,6-diethoxyphenyl)-3-(2,6-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,6-diethoxyphenyl)-3-(2,6-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24828195 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (E)-1-(2,6-diethoxyphenyl)-3-(2,6-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1cccc(OCC)c1C(=O)/C=C/c1c(OC)cccc1OC |
| InChI | InChI=1S/C21H24O5/c1-5-25-19-11-8-12-20(26-6-2)21(19)16(22)14-13-15-17(23-3)9-7-10-18(15)24-4/h7-14H,5-6H2,1-4H3/b14-13+ |
| InChIKey | QIPSEHJFODSFMH-BUHFOSPRSA-N |
| XLogP | 4.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|