C22H24O7S — CID 57480438
(Z)-4-(2,6-dimethoxyphenyl)-1-[(E)-2-(2,6-dimethoxyphenyl)ethenyl]sulfonylbut-3-en-2-one (PubChem CID 57480438) has the molecular formula C22H24O7S and a molecular weight of 432.49 g/mol. Its IUPAC name is (Z)-4-(2,6-dimethoxyphenyl)-1-[(E)-2-(2,6-dimethoxyphenyl)ethenyl]sulfonylbut-3-en-2-one.
| Compound Name | (Z)-4-(2,6-dimethoxyphenyl)-1-[(E)-2-(2,6-dimethoxyphenyl)ethenyl]sulfonylbut-3-en-2-one |
|---|---|
| PubChem CID | 57480438 |
| Molecular Formula | C22H24O7S |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (Z)-4-(2,6-dimethoxyphenyl)-1-[(E)-2-(2,6-dimethoxyphenyl)ethenyl]sulfonylbut-3-en-2-one |
| SMILES | COc1cccc(OC)c1/C=C\C(=O)CS(=O)(=O)/C=C/c1c(OC)cccc1OC |
| InChI | InChI=1S/C22H24O7S/c1-26-19-7-5-8-20(27-2)17(19)12-11-16(23)15-30(24,25)14-13-18-21(28-3)9-6-10-22(18)29-4/h5-14H,15H2,1-4H3/b12-11-,14-13+ |
| InChIKey | QEVKZVVBPLOKHR-RCWDKCQFSA-N |
| XLogP | 3.39 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|