C21H18F2O4 — CID 123367153
(1E,6E)-1,7-bis(2-fluoro-6-methoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 123367153) has the molecular formula C21H18F2O4 and a molecular weight of 372.37 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(2-fluoro-6-methoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis(2-fluoro-6-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 123367153 |
| Molecular Formula | C21H18F2O4 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (1E,6E)-1,7-bis(2-fluoro-6-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cccc(F)c1/C=C/C(=O)CC(=O)/C=C/c1c(F)cccc1OC |
| InChI | InChI=1S/C21H18F2O4/c1-26-20-7-3-5-18(22)16(20)11-9-14(24)13-15(25)10-12-17-19(23)6-4-8-21(17)27-2/h3-12H,13H2,1-2H3/b11-9+,12-10+ |
| InChIKey | JBVRLDSNPXWEML-WGDLNXRISA-N |
| XLogP | 4.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|