C22H25NO7S — CID 69486170
4-(2,6-dimethoxyphenyl)-N-[2-(2,6-dimethoxyphenyl)ethenyl]-2-oxobut-3-ene-1-sulfonamide (PubChem CID 69486170) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-N-[2-(2,6-dimethoxyphenyl)ethenyl]-2-oxobut-3-ene-1-sulfonamide.
| Compound Name | 4-(2,6-dimethoxyphenyl)-N-[2-(2,6-dimethoxyphenyl)ethenyl]-2-oxobut-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 69486170 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-N-[2-(2,6-dimethoxyphenyl)ethenyl]-2-oxobut-3-ene-1-sulfonamide |
| SMILES | COc1cccc(OC)c1C=CNS(=O)(=O)CC(=O)C=Cc1c(OC)cccc1OC |
| InChI | InChI=1S/C22H25NO7S/c1-27-19-7-5-8-20(28-2)17(19)12-11-16(24)15-31(25,26)23-14-13-18-21(29-3)9-6-10-22(18)30-4/h5-14,23H,15H2,1-4H3 |
| InChIKey | MMRGDEZYZXVWDA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|