C21H23NO7S — CID 67287109
(Z)-3-(2,6-dimethoxyphenyl)-N-[1-(2,6-dimethoxyphenyl)ethenylsulfonyl]prop-2-enamide (PubChem CID 67287109) has the molecular formula C21H23NO7S and a molecular weight of 433.48 g/mol. Its IUPAC name is (Z)-3-(2,6-dimethoxyphenyl)-N-[1-(2,6-dimethoxyphenyl)ethenylsulfonyl]prop-2-enamide.
| Compound Name | (Z)-3-(2,6-dimethoxyphenyl)-N-[1-(2,6-dimethoxyphenyl)ethenylsulfonyl]prop-2-enamide |
|---|---|
| PubChem CID | 67287109 |
| Molecular Formula | C21H23NO7S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (Z)-3-(2,6-dimethoxyphenyl)-N-[1-(2,6-dimethoxyphenyl)ethenylsulfonyl]prop-2-enamide |
| SMILES | C=C(c1c(OC)cccc1OC)S(=O)(=O)NC(=O)/C=C\c1c(OC)cccc1OC |
| InChI | InChI=1S/C21H23NO7S/c1-14(21-18(28-4)10-7-11-19(21)29-5)30(24,25)22-20(23)13-12-15-16(26-2)8-6-9-17(15)27-3/h6-13H,1H2,2-5H3,(H,22,23)/b13-12- |
| InChIKey | ZMCMHQWAOCQCJP-SEYXRHQNSA-N |
| XLogP | 2.85 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|