C24H28O9S — CID 11511540
(E)-4-(3,4,5-trimethoxyphenyl)-1-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]sulfonylbut-3-en-2-one (PubChem CID 11511540) has the molecular formula C24H28O9S and a molecular weight of 492.55 g/mol. Its IUPAC name is (E)-4-(3,4,5-trimethoxyphenyl)-1-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]sulfonylbut-3-en-2-one.
| Compound Name | (E)-4-(3,4,5-trimethoxyphenyl)-1-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]sulfonylbut-3-en-2-one |
|---|---|
| PubChem CID | 11511540 |
| Molecular Formula | C24H28O9S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (E)-4-(3,4,5-trimethoxyphenyl)-1-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]sulfonylbut-3-en-2-one |
| SMILES | COc1cc(/C=C\S(=O)(=O)CC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H28O9S/c1-28-19-11-16(12-20(29-2)23(19)32-5)7-8-18(25)15-34(26,27)10-9-17-13-21(30-3)24(33-6)22(14-17)31-4/h7-14H,15H2,1-6H3/b8-7+,10-9- |
| InChIKey | TVXAICAYSGVOAJ-GOJKSUSPSA-N |
| XLogP | 3.41 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|