C13H14O6S — CID 173037255
1-sulfonyl-4-(3,4,5-trimethoxyphenyl)but-3-en-2-one (PubChem CID 173037255) has the molecular formula C13H14O6S and a molecular weight of 298.32 g/mol. Its IUPAC name is 1-sulfonyl-4-(3,4,5-trimethoxyphenyl)but-3-en-2-one.
| Compound Name | 1-sulfonyl-4-(3,4,5-trimethoxyphenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 173037255 |
| Molecular Formula | C13H14O6S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 1-sulfonyl-4-(3,4,5-trimethoxyphenyl)but-3-en-2-one |
| SMILES | COc1cc(C=CC(=O)C=S(=O)=O)cc(OC)c1OC |
| InChI | InChI=1S/C13H14O6S/c1-17-11-6-9(4-5-10(14)8-20(15)16)7-12(18-2)13(11)19-3/h4-8H,1-3H3 |
| InChIKey | NDHBSNORKBHVLQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|