C23H26O7 — CID 46231643
(1E,4E)-1-(2,3,4-trimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one (PubChem CID 46231643) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is (1E,4E)-1-(2,3,4-trimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(2,3,4-trimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 46231643 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (1E,4E)-1-(2,3,4-trimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2ccc(OC)c(OC)c2OC)cc(OC)c1OC |
| InChI | InChI=1S/C23H26O7/c1-25-18-12-9-16(21(28-4)23(18)30-6)8-11-17(24)10-7-15-13-19(26-2)22(29-5)20(14-15)27-3/h7-14H,1-6H3/b10-7+,11-8+ |
| InChIKey | PLGXVWJTQUDNML-AMMQDNIMSA-N |
| XLogP | 4.03 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|