C21H22O6 — CID 127040112
(1E,4E)-1-(4-hydroxy-3-methoxyphenyl)-5-(2,3,4-trimethoxyphenyl)penta-1,4-dien-3-one (PubChem CID 127040112) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is (1E,4E)-1-(4-hydroxy-3-methoxyphenyl)-5-(2,3,4-trimethoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(4-hydroxy-3-methoxyphenyl)-5-(2,3,4-trimethoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 127040112 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (1E,4E)-1-(4-hydroxy-3-methoxyphenyl)-5-(2,3,4-trimethoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2ccc(OC)c(OC)c2OC)ccc1O |
| InChI | InChI=1S/C21H22O6/c1-24-18-12-8-15(20(26-3)21(18)27-4)7-10-16(22)9-5-14-6-11-17(23)19(13-14)25-2/h5-13,23H,1-4H3/b9-5+,10-7+ |
| InChIKey | REZBRNMQUWQBPX-FWMCCXIMSA-N |
| XLogP | 3.72 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|