C19H21Na2O9P — CID 58600722
disodium;[2,6-dimethoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate (PubChem CID 58600722) has the molecular formula C19H21Na2O9P and a molecular weight of 470.32 g/mol. Its IUPAC name is disodium;[2,6-dimethoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate.
| Compound Name | disodium;[2,6-dimethoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate |
|---|---|
| PubChem CID | 58600722 |
| Molecular Formula | C19H21Na2O9P |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | disodium;[2,6-dimethoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(OP(=O)([O-])[O-])c2OC)cc(OC)c1OC.[Na+].[Na+] |
| InChI | InChI=1S/C19H23O9P.2Na/c1-23-14-9-8-13(17(26-4)19(14)28-29(20,21)22)7-6-12-10-15(24-2)18(27-5)16(11-12)25-3;;/h6-11H,1-5H3,(H2,20,21,22);;/q;2*+1/p-2/b7-6-;; |
| InChIKey | OZZRPEXCGCIUTI-AQTVDGORSA-L |
| XLogP | -3.88 |
| TPSA | 118.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|