C25H25Na2O11PS — CID 53465493
disodium;[6-methoxy-2-(4-methylphenyl)sulfonyloxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate (PubChem CID 53465493) has the molecular formula C25H25Na2O11PS and a molecular weight of 610.49 g/mol. Its IUPAC name is disodium;[6-methoxy-2-(4-methylphenyl)sulfonyloxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate.
| Compound Name | disodium;[6-methoxy-2-(4-methylphenyl)sulfonyloxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate |
|---|---|
| PubChem CID | 53465493 |
| Molecular Formula | C25H25Na2O11PS |
| Molecular Weight | 610.49 g/mol |
| Exact Mass | 610.07 |
| IUPAC Name | disodium;[6-methoxy-2-(4-methylphenyl)sulfonyloxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(OP(=O)([O-])[O-])c2OS(=O)(=O)c2ccc(C)cc2)cc(OC)c1OC.[Na+].[Na+] |
| InChI | InChI=1S/C25H27O11PS.2Na/c1-16-6-11-19(12-7-16)38(29,30)36-23-18(10-13-20(31-2)25(23)35-37(26,27)28)9-8-17-14-21(32-3)24(34-5)22(15-17)33-4;;/h6-15H,1-5H3,(H2,26,27,28);;/q;2*+1/p-2/b9-8-;; |
| InChIKey | QUEZLTARMMFWOV-ULDSSAIZSA-L |
| XLogP | -2.82 |
| TPSA | 152.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.49 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|