C18H21O9P — CID 53465498
[2-hydroxy-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate (PubChem CID 53465498) has the molecular formula C18H21O9P and a molecular weight of 412.33 g/mol. Its IUPAC name is [2-hydroxy-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate.
| Compound Name | [2-hydroxy-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 53465498 |
| Molecular Formula | C18H21O9P |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [2-hydroxy-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(OP(=O)(O)O)c2O)cc(OC)c1OC |
| InChI | InChI=1S/C18H21O9P/c1-23-13-8-7-12(16(19)18(13)27-28(20,21)22)6-5-11-9-14(24-2)17(26-4)15(10-11)25-3/h5-10,19H,1-4H3,(H2,20,21,22)/b6-5- |
| InChIKey | QKUYFYMNSOBUDG-WAYWQWQTSA-N |
| XLogP | 3.07 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|