C24H28O12 — CID 46848776
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-hydroxy-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]oxane-2-carboxylic acid (PubChem CID 46848776) has the molecular formula C24H28O12 and a molecular weight of 508.48 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-hydroxy-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-hydroxy-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 46848776 |
| Molecular Formula | C24H28O12 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-hydroxy-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]oxane-2-carboxylic acid |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)c2O)cc(OC)c1OC |
| InChI | InChI=1S/C24H28O12/c1-31-13-8-7-12(6-5-11-9-14(32-2)20(34-4)15(10-11)33-3)16(25)21(13)35-24-19(28)17(26)18(27)22(36-24)23(29)30/h5-10,17-19,22,24-28H,1-4H3,(H,29,30)/b6-5-/t17-,18-,19+,22-,24+/m0/s1 |
| InChIKey | DLBORVSAKZBVMO-CXUJUTRJSA-N |
| XLogP | 0.87 |
| TPSA | 173.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|