C17H20O10 — CID 102354834
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]oxane-2-carboxylic acid (PubChem CID 102354834) has the molecular formula C17H20O10 and a molecular weight of 384.34 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 102354834 |
| Molecular Formula | C17H20O10 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]oxane-2-carboxylic acid |
| SMILES | COC(=O)/C=C/c1ccc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c(OC)c1 |
| InChI | InChI=1S/C17H20O10/c1-24-10-7-8(4-6-11(18)25-2)3-5-9(10)26-17-14(21)12(19)13(20)15(27-17)16(22)23/h3-7,12-15,17,19-21H,1-2H3,(H,22,23)/b6-4+/t12-,13-,14+,15-,17+/m0/s1 |
| InChIKey | RTBXKIINJBMVMP-HAJGIBAISA-N |
| XLogP | -0.85 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|