C19H25NO9 — CID 124839962
methyl (E)-3-[4-[(2S,3R,4S,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-methoxyphenyl]prop-2-enoate (PubChem CID 124839962) has the molecular formula C19H25NO9 and a molecular weight of 411.41 g/mol. Its IUPAC name is methyl (E)-3-[4-[(2S,3R,4S,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-methoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[(2S,3R,4S,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 124839962 |
| Molecular Formula | C19H25NO9 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | methyl (E)-3-[4-[(2S,3R,4S,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-methoxyphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(O[C@@H]2O[C@H](CO)[C@H](O)[C@@H](O)[C@H]2NC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C19H25NO9/c1-10(22)20-16-18(25)17(24)14(9-21)29-19(16)28-12-6-4-11(8-13(12)26-2)5-7-15(23)27-3/h4-8,14,16-19,21,24-25H,9H2,1-3H3,(H,20,22)/b7-5+/t14-,16-,17+,18+,19-/m1/s1 |
| InChIKey | IFWVVCRXMWYOSY-JKKBCEDHSA-N |
| XLogP | -0.80 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|