C18H24O9 — CID 162884525
ethyl 3-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate (PubChem CID 162884525) has the molecular formula C18H24O9 and a molecular weight of 384.38 g/mol. Its IUPAC name is ethyl 3-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate.
| Compound Name | ethyl 3-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 162884525 |
| Molecular Formula | C18H24O9 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | ethyl 3-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(OC2OC(CO)C(O)C(O)C2O)c(OC)c1 |
| InChI | InChI=1S/C18H24O9/c1-3-25-14(20)7-5-10-4-6-11(12(8-10)24-2)26-18-17(23)16(22)15(21)13(9-19)27-18/h4-8,13,15-19,21-23H,3,9H2,1-2H3 |
| InChIKey | IBNPXLCLALXSNA-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|