C18H26O8 — CID 162872940
2-[4-(3-ethoxyprop-1-enyl)-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162872940) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-[4-(3-ethoxyprop-1-enyl)-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[4-(3-ethoxyprop-1-enyl)-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162872940 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-[4-(3-ethoxyprop-1-enyl)-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOCC=Cc1ccc(OC2OC(CO)C(O)C(O)C2O)c(OC)c1 |
| InChI | InChI=1S/C18H26O8/c1-3-24-8-4-5-11-6-7-12(13(9-11)23-2)25-18-17(22)16(21)15(20)14(10-19)26-18/h4-7,9,14-22H,3,8,10H2,1-2H3 |
| InChIKey | KLLBPHKQGRRWIY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|