C17H23NO8 — CID 51435534
N-[(2S,3R,4S,5S,6S)-2-(4-acetyl-2-methoxyphenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 51435534) has the molecular formula C17H23NO8 and a molecular weight of 369.37 g/mol. Its IUPAC name is N-[(2S,3R,4S,5S,6S)-2-(4-acetyl-2-methoxyphenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4S,5S,6S)-2-(4-acetyl-2-methoxyphenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 51435534 |
| Molecular Formula | C17H23NO8 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-[(2S,3R,4S,5S,6S)-2-(4-acetyl-2-methoxyphenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | COc1cc(C(C)=O)ccc1O[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H23NO8/c1-8(20)10-4-5-11(12(6-10)24-3)25-17-14(18-9(2)21)16(23)15(22)13(7-19)26-17/h4-6,13-17,19,22-23H,7H2,1-3H3,(H,18,21)/t13-,14+,15+,16-,17+/m0/s1 |
| InChIKey | WBZPZQHNUOYGIO-JZAWBGDQSA-N |
| XLogP | -0.78 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |