C17H25NO8 — CID 24748007
N-[(2R,3R,4R,5S,6R)-2-[(3,4-dimethoxyphenyl)methoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 24748007) has the molecular formula C17H25NO8 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-[(3,4-dimethoxyphenyl)methoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-[(3,4-dimethoxyphenyl)methoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 24748007 |
| Molecular Formula | C17H25NO8 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-[(3,4-dimethoxyphenyl)methoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | COc1ccc(CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)cc1OC |
| InChI | InChI=1S/C17H25NO8/c1-9(20)18-14-16(22)15(21)13(7-19)26-17(14)25-8-10-4-5-11(23-2)12(6-10)24-3/h4-6,13-17,19,21-22H,7-8H2,1-3H3,(H,18,20)/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | HVWWOTDKTUZKIN-WRQOLXDDSA-N |
| XLogP | -0.84 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |