C15H16O10 — CID 131700414
(3S,6S)-6-[4-[(E)-2-carboxyethenyl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 131700414) has the molecular formula C15H16O10 and a molecular weight of 356.28 g/mol. Its IUPAC name is (3S,6S)-6-[4-[(E)-2-carboxyethenyl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3S,6S)-6-[4-[(E)-2-carboxyethenyl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131700414 |
| Molecular Formula | C15H16O10 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (3S,6S)-6-[4-[(E)-2-carboxyethenyl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)/C=C/c1ccc(O[C@@H]2OC(C(=O)O)[C@@H](O)C(O)C2O)c(O)c1 |
| InChI | InChI=1S/C15H16O10/c16-7-5-6(2-4-9(17)18)1-3-8(7)24-15-12(21)10(19)11(20)13(25-15)14(22)23/h1-5,10-13,15-16,19-21H,(H,17,18)(H,22,23)/b4-2+/t10?,11-,12?,13?,15+/m0/s1 |
| InChIKey | LTGOIJNQWZWJRF-MPHDXGAUSA-N |
| XLogP | -1.24 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|