C16H20O8 — CID 122463176
(E)-3-[4-[3,5-dihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-3-hydroxyphenyl]prop-2-enoic acid (PubChem CID 122463176) has the molecular formula C16H20O8 and a molecular weight of 340.33 g/mol. Its IUPAC name is (E)-3-[4-[3,5-dihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-3-hydroxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3,5-dihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-3-hydroxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 122463176 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (E)-3-[4-[3,5-dihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-3-hydroxyphenyl]prop-2-enoic acid |
| SMILES | CC1C(O)C(CO)OC(Oc2ccc(/C=C/C(=O)O)cc2O)C1O |
| InChI | InChI=1S/C16H20O8/c1-8-14(21)12(7-17)24-16(15(8)22)23-11-4-2-9(6-10(11)18)3-5-13(19)20/h2-6,8,12,14-18,21-22H,7H2,1H3,(H,19,20)/b5-3+ |
| InChIKey | TWZAPJWXCUQZLC-HWKANZROSA-N |
| XLogP | -0.06 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|