C20H19NO7 — CID 142236837
(E)-3-[3-hydroxy-4-[3-hydroxy-5-(hydroxymethyl)-4-nitrosooxolan-2-yl]oxyphenyl]-1-phenylprop-2-en-1-one (PubChem CID 142236837) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is (E)-3-[3-hydroxy-4-[3-hydroxy-5-(hydroxymethyl)-4-nitrosooxolan-2-yl]oxyphenyl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[3-hydroxy-4-[3-hydroxy-5-(hydroxymethyl)-4-nitrosooxolan-2-yl]oxyphenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 142236837 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (E)-3-[3-hydroxy-4-[3-hydroxy-5-(hydroxymethyl)-4-nitrosooxolan-2-yl]oxyphenyl]-1-phenylprop-2-en-1-one |
| SMILES | O=NC1C(CO)OC(Oc2ccc(/C=C/C(=O)c3ccccc3)cc2O)C1O |
| InChI | InChI=1S/C20H19NO7/c22-11-17-18(21-26)19(25)20(28-17)27-16-9-7-12(10-15(16)24)6-8-14(23)13-4-2-1-3-5-13/h1-10,17-20,22,24-25H,11H2/b8-6+ |
| InChIKey | HNALVFBYRXCIBB-SOFGYWHQSA-N |
| XLogP | 1.88 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|