C27H32O15 — CID 162972665
[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 3-[3-hydroxy-4-[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate (PubChem CID 162972665) has the molecular formula C27H32O15 and a molecular weight of 596.54 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 3-[3-hydroxy-4-[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 3-[3-hydroxy-4-[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 162972665 |
| Molecular Formula | C27H32O15 |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 3-[3-hydroxy-4-[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O[C@H]2O[C@@H](CO)[C@H](O)[C@H](O)[C@H]2O)c(O)c1)OC[C@H]1O[C@@H](Oc2ccc(O)cc2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H32O15/c28-10-17-20(32)22(34)25(37)27(41-17)40-16-7-1-12(9-15(16)30)2-8-19(31)38-11-18-21(33)23(35)24(36)26(42-18)39-14-5-3-13(29)4-6-14/h1-9,17-18,20-30,32-37H,10-11H2/t17-,18+,20-,21-,22-,23+,24+,25+,26+,27-/m0/s1 |
| InChIKey | LVNKDWCWDJNUNM-RVOOFLITSA-N |
| XLogP | -2.28 |
| TPSA | 245.29 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|