C21H22O11 — CID 162983717
[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 162983717) has the molecular formula C21H22O11 and a molecular weight of 450.40 g/mol. Its IUPAC name is [3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162983717 |
| Molecular Formula | C21H22O11 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)Oc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c1 |
| InChI | InChI=1S/C21H22O11/c22-9-16-18(27)19(28)20(29)21(32-16)31-15-5-3-11(8-14(15)25)30-17(26)6-2-10-1-4-12(23)13(24)7-10/h1-8,16,18-25,27-29H,9H2/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | NDJVPSMTWRPAND-QNDFHXLGSA-N |
| XLogP | -0.40 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|